C23H22FN3 — CID 42458001
(1R)-N-[(2-fluorophenyl)methyl]-1-(5-methyl-1-naphthalen-1-ylpyrazol-4-yl)ethanamine (PubChem CID 42458001) has the molecular formula C23H22FN3 and a molecular weight of 359.45 g/mol. Its IUPAC name is (1R)-N-[(2-fluorophenyl)methyl]-1-(5-methyl-1-naphthalen-1-ylpyrazol-4-yl)ethanamine.
| Compound Name | (1R)-N-[(2-fluorophenyl)methyl]-1-(5-methyl-1-naphthalen-1-ylpyrazol-4-yl)ethanamine |
|---|---|
| PubChem CID | 42458001 |
| Molecular Formula | C23H22FN3 |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | (1R)-N-[(2-fluorophenyl)methyl]-1-(5-methyl-1-naphthalen-1-ylpyrazol-4-yl)ethanamine |
| SMILES | Cc1c([C@@H](C)NCc2ccccc2F)cnn1-c1cccc2ccccc12 |
| InChI | InChI=1S/C23H22FN3/c1-16(25-14-19-9-4-6-12-22(19)24)21-15-26-27(17(21)2)23-13-7-10-18-8-3-5-11-20(18)23/h3-13,15-16,25H,14H2,1-2H3/t16-/m1/s1 |
| InChIKey | DUWQNNQXGORUDA-MRXNPFEDSA-N |
| XLogP | 5.32 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |