C34H30N2O6S — CID 4245851
methyl 4-[9-(3,4-dimethoxyphenyl)-7-oxo-5-(thiophene-2-carbonyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-6-yl]benzoate (PubChem CID 4245851) has the molecular formula C34H30N2O6S and a molecular weight of 594.69 g/mol. Its IUPAC name is methyl 4-[9-(3,4-dimethoxyphenyl)-7-oxo-5-(thiophene-2-carbonyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-6-yl]benzoate.
| Compound Name | methyl 4-[9-(3,4-dimethoxyphenyl)-7-oxo-5-(thiophene-2-carbonyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-6-yl]benzoate |
|---|---|
| PubChem CID | 4245851 |
| Molecular Formula | C34H30N2O6S |
| Molecular Weight | 594.69 g/mol |
| Exact Mass | 594.18 |
| IUPAC Name | methyl 4-[9-(3,4-dimethoxyphenyl)-7-oxo-5-(thiophene-2-carbonyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-6-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2C3=C(CC(c4ccc(OC)c(OC)c4)CC3=O)Nc3ccccc3N2C(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C34H30N2O6S/c1-40-28-15-14-22(19-29(28)41-2)23-17-25-31(27(37)18-23)32(20-10-12-21(13-11-20)34(39)42-3)36(33(38)30-9-6-16-43-30)26-8-5-4-7-24(26)35-25/h4-16,19,23,32,35H,17-18H2,1-3H3 |
| InChIKey | LWOGOHBSVIGFHK-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.69 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |