C39H33ClN2O4S — CID 92905548
(6S,9S)-6-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-9-phenyl-5-(thiophene-2-carbonyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 92905548) has the molecular formula C39H33ClN2O4S and a molecular weight of 661.22 g/mol. Its IUPAC name is (6S,9S)-6-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-9-phenyl-5-(thiophene-2-carbonyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6S,9S)-6-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-9-phenyl-5-(thiophene-2-carbonyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 92905548 |
| Molecular Formula | C39H33ClN2O4S |
| Molecular Weight | 661.22 g/mol |
| Exact Mass | 660.18 |
| IUPAC Name | (6S,9S)-6-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-9-phenyl-5-(thiophene-2-carbonyl)-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCOc1cc([C@H]2C3=C(C[C@H](c4ccccc4)CC3=O)Nc3ccccc3N2C(=O)c2cccs2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C39H33ClN2O4S/c1-2-45-35-23-27(16-19-34(35)46-24-25-14-17-29(40)18-15-25)38-37-31(21-28(22-33(37)43)26-9-4-3-5-10-26)41-30-11-6-7-12-32(30)42(38)39(44)36-13-8-20-47-36/h3-20,23,28,38,41H,2,21-22,24H2,1H3/t28-,38-/m0/s1 |
| InChIKey | GEGDYHYQKVHQKW-SNFDCCKOSA-N |
| XLogP | 9.59 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.22 |
| LogP ≤ 5 | 9.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |