C40H40Cl2N2O4 — CID 99660889
(6S,9S)-9-(4-chlorophenyl)-6-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-5-hexanoyl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one (PubChem CID 99660889) has the molecular formula C40H40Cl2N2O4 and a molecular weight of 683.68 g/mol. Its IUPAC name is (6S,9S)-9-(4-chlorophenyl)-6-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-5-hexanoyl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one.
| Compound Name | (6S,9S)-9-(4-chlorophenyl)-6-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-5-hexanoyl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
|---|---|
| PubChem CID | 99660889 |
| Molecular Formula | C40H40Cl2N2O4 |
| Molecular Weight | 683.68 g/mol |
| Exact Mass | 682.24 |
| IUPAC Name | (6S,9S)-9-(4-chlorophenyl)-6-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]-5-hexanoyl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| SMILES | CCCCCC(=O)N1c2ccccc2NC2=C(C(=O)C[C@@H](c3ccc(Cl)cc3)C2)[C@@H]1c1ccc(OCc2ccc(Cl)cc2)c(OCC)c1 |
| InChI | InChI=1S/C40H40Cl2N2O4/c1-3-5-6-11-38(46)44-34-10-8-7-9-32(34)43-33-22-29(27-14-19-31(42)20-15-27)23-35(45)39(33)40(44)28-16-21-36(37(24-28)47-4-2)48-25-26-12-17-30(41)18-13-26/h7-10,12-21,24,29,40,43H,3-6,11,22-23,25H2,1-2H3/t29-,40-/m0/s1 |
| InChIKey | CAJNJSGKHRQOQR-YLZGDECLSA-N |
| XLogP | 10.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.68 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|