C28H35N3O3 — CID 42458784
1-cyclohexyl-3-(4-phenylpiperidine-1-carbonyl)-5-(pyrrolidine-1-carbonyl)pyridin-4-one (PubChem CID 42458784) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is 1-cyclohexyl-3-(4-phenylpiperidine-1-carbonyl)-5-(pyrrolidine-1-carbonyl)pyridin-4-one.
| Compound Name | 1-cyclohexyl-3-(4-phenylpiperidine-1-carbonyl)-5-(pyrrolidine-1-carbonyl)pyridin-4-one |
|---|---|
| PubChem CID | 42458784 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | 1-cyclohexyl-3-(4-phenylpiperidine-1-carbonyl)-5-(pyrrolidine-1-carbonyl)pyridin-4-one |
| SMILES | O=C(c1cn(C2CCCCC2)cc(C(=O)N2CCC(c3ccccc3)CC2)c1=O)N1CCCC1 |
| InChI | InChI=1S/C28H35N3O3/c32-26-24(27(33)29-15-7-8-16-29)19-31(23-11-5-2-6-12-23)20-25(26)28(34)30-17-13-22(14-18-30)21-9-3-1-4-10-21/h1,3-4,9-10,19-20,22-23H,2,5-8,11-18H2 |
| InChIKey | KQQILWKLKGNJPT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |