C24H33NO5 — CID 42459916
ethyl 4-[[(2R)-oxan-2-yl]methyl]-1-(3-prop-2-enoxybenzoyl)piperidine-4-carboxylate (PubChem CID 42459916) has the molecular formula C24H33NO5 and a molecular weight of 415.53 g/mol. Its IUPAC name is ethyl 4-[[(2R)-oxan-2-yl]methyl]-1-(3-prop-2-enoxybenzoyl)piperidine-4-carboxylate.
| Compound Name | ethyl 4-[[(2R)-oxan-2-yl]methyl]-1-(3-prop-2-enoxybenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 42459916 |
| Molecular Formula | C24H33NO5 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | ethyl 4-[[(2R)-oxan-2-yl]methyl]-1-(3-prop-2-enoxybenzoyl)piperidine-4-carboxylate |
| SMILES | C=CCOc1cccc(C(=O)N2CCC(C[C@H]3CCCCO3)(C(=O)OCC)CC2)c1 |
| InChI | InChI=1S/C24H33NO5/c1-3-15-29-20-10-7-8-19(17-20)22(26)25-13-11-24(12-14-25,23(27)28-4-2)18-21-9-5-6-16-30-21/h3,7-8,10,17,21H,1,4-6,9,11-16,18H2,2H3/t21-/m1/s1 |
| InChIKey | TZWBOOCJFCJRFG-OAQYLSRUSA-N |
| XLogP | 4.00 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|