C23H32N2O6 — CID 45241326
ethyl 1-[(2-methoxycarbonylphenyl)carbamoyl]-4-(oxan-2-ylmethyl)piperidine-4-carboxylate (PubChem CID 45241326) has the molecular formula C23H32N2O6 and a molecular weight of 432.52 g/mol. Its IUPAC name is ethyl 1-[(2-methoxycarbonylphenyl)carbamoyl]-4-(oxan-2-ylmethyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(2-methoxycarbonylphenyl)carbamoyl]-4-(oxan-2-ylmethyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 45241326 |
| Molecular Formula | C23H32N2O6 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | ethyl 1-[(2-methoxycarbonylphenyl)carbamoyl]-4-(oxan-2-ylmethyl)piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1(CC2CCCCO2)CCN(C(=O)Nc2ccccc2C(=O)OC)CC1 |
| InChI | InChI=1S/C23H32N2O6/c1-3-30-21(27)23(16-17-8-6-7-15-31-17)11-13-25(14-12-23)22(28)24-19-10-5-4-9-18(19)20(26)29-2/h4-5,9-10,17H,3,6-8,11-16H2,1-2H3,(H,24,28) |
| InChIKey | YOWCMSYHRJVTRK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |