C25H34N2O3 — CID 42462493
(5S)-5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-[2-(4-methoxyphenyl)ethyl]piperidin-2-one (PubChem CID 42462493) has the molecular formula C25H34N2O3 and a molecular weight of 410.56 g/mol. Its IUPAC name is (5S)-5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-[2-(4-methoxyphenyl)ethyl]piperidin-2-one.
| Compound Name | (5S)-5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-[2-(4-methoxyphenyl)ethyl]piperidin-2-one |
|---|---|
| PubChem CID | 42462493 |
| Molecular Formula | C25H34N2O3 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | (5S)-5-[2,2-bis(prop-2-enyl)pyrrolidine-1-carbonyl]-1-[2-(4-methoxyphenyl)ethyl]piperidin-2-one |
| SMILES | C=CCC1(CC=C)CCCN1C(=O)[C@H]1CCC(=O)N(CCc2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C25H34N2O3/c1-4-14-25(15-5-2)16-6-17-27(25)24(29)21-9-12-23(28)26(19-21)18-13-20-7-10-22(30-3)11-8-20/h4-5,7-8,10-11,21H,1-2,6,9,12-19H2,3H3/t21-/m0/s1 |
| InChIKey | DMYJBYHNAUCCQL-NRFANRHFSA-N |
| XLogP | 3.99 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|