C17H20N6O2 — CID 42464619
N-[(1-ethylpyrazol-4-yl)methyl]-1-[(4-methoxyphenyl)methyl]triazole-4-carboxamide (PubChem CID 42464619) has the molecular formula C17H20N6O2 and a molecular weight of 340.39 g/mol. Its IUPAC name is N-[(1-ethylpyrazol-4-yl)methyl]-1-[(4-methoxyphenyl)methyl]triazole-4-carboxamide.
| Compound Name | N-[(1-ethylpyrazol-4-yl)methyl]-1-[(4-methoxyphenyl)methyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 42464619 |
| Molecular Formula | C17H20N6O2 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-[(1-ethylpyrazol-4-yl)methyl]-1-[(4-methoxyphenyl)methyl]triazole-4-carboxamide |
| SMILES | CCn1cc(CNC(=O)c2cn(Cc3ccc(OC)cc3)nn2)cn1 |
| InChI | InChI=1S/C17H20N6O2/c1-3-22-11-14(9-19-22)8-18-17(24)16-12-23(21-20-16)10-13-4-6-15(25-2)7-5-13/h4-7,9,11-12H,3,8,10H2,1-2H3,(H,18,24) |
| InChIKey | LOEGICFYFOFKSY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |