C15H19N5O4 — CID 175662114
methyl 2-amino-3-[4-[(4-methoxyphenyl)methylcarbamoyl]triazol-1-yl]propanoate (PubChem CID 175662114) has the molecular formula C15H19N5O4 and a molecular weight of 333.35 g/mol. Its IUPAC name is methyl 2-amino-3-[4-[(4-methoxyphenyl)methylcarbamoyl]triazol-1-yl]propanoate.
| Compound Name | methyl 2-amino-3-[4-[(4-methoxyphenyl)methylcarbamoyl]triazol-1-yl]propanoate |
|---|---|
| PubChem CID | 175662114 |
| Molecular Formula | C15H19N5O4 |
| Molecular Weight | 333.35 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | methyl 2-amino-3-[4-[(4-methoxyphenyl)methylcarbamoyl]triazol-1-yl]propanoate |
| SMILES | COC(=O)C(N)Cn1cc(C(=O)NCc2ccc(OC)cc2)nn1 |
| InChI | InChI=1S/C15H19N5O4/c1-23-11-5-3-10(4-6-11)7-17-14(21)13-9-20(19-18-13)8-12(16)15(22)24-2/h3-6,9,12H,7-8,16H2,1-2H3,(H,17,21) |
| InChIKey | UHEUNROAWCBYME-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.35 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |