C17H15F3N2O2S — CID 4246520
N-[(4-methylsulfanylphenyl)methylideneamino]-2-[3-(trifluoromethyl)phenoxy]acetamide (PubChem CID 4246520) has the molecular formula C17H15F3N2O2S and a molecular weight of 368.38 g/mol. Its IUPAC name is N-[(4-methylsulfanylphenyl)methylideneamino]-2-[3-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-[(4-methylsulfanylphenyl)methylideneamino]-2-[3-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 4246520 |
| Molecular Formula | C17H15F3N2O2S |
| Molecular Weight | 368.38 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | N-[(4-methylsulfanylphenyl)methylideneamino]-2-[3-(trifluoromethyl)phenoxy]acetamide |
| SMILES | CSc1ccc(C=NNC(=O)COc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H15F3N2O2S/c1-25-15-7-5-12(6-8-15)10-21-22-16(23)11-24-14-4-2-3-13(9-14)17(18,19)20/h2-10H,11H2,1H3,(H,22,23) |
| InChIKey | PJUFVGLEAYFNCO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|