C15H13F3N2O3 — CID 42991542
N-[(E)-(5-methylfuran-2-yl)methylideneamino]-2-[3-(trifluoromethyl)phenoxy]acetamide (PubChem CID 42991542) has the molecular formula C15H13F3N2O3 and a molecular weight of 326.27 g/mol. Its IUPAC name is N-[(E)-(5-methylfuran-2-yl)methylideneamino]-2-[3-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-[(E)-(5-methylfuran-2-yl)methylideneamino]-2-[3-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 42991542 |
| Molecular Formula | C15H13F3N2O3 |
| Molecular Weight | 326.27 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | N-[(E)-(5-methylfuran-2-yl)methylideneamino]-2-[3-(trifluoromethyl)phenoxy]acetamide |
| SMILES | Cc1ccc(/C=N/NC(=O)COc2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C15H13F3N2O3/c1-10-5-6-13(23-10)8-19-20-14(21)9-22-12-4-2-3-11(7-12)15(16,17)18/h2-8H,9H2,1H3,(H,20,21)/b19-8+ |
| InChIKey | UPOCWPXANSNVQE-UFWORHAWSA-N |
| XLogP | 3.14 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.27 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|