C24H43NO — CID 4246683
2-[2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctoxy]aniline (PubChem CID 4246683) has the molecular formula C24H43NO and a molecular weight of 361.61 g/mol. Its IUPAC name is 2-[2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctoxy]aniline.
| Compound Name | 2-[2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctoxy]aniline |
|---|---|
| PubChem CID | 4246683 |
| Molecular Formula | C24H43NO |
| Molecular Weight | 361.61 g/mol |
| Exact Mass | 361.33 |
| IUPAC Name | 2-[2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctoxy]aniline |
| SMILES | CC(CCC(COc1ccccc1N)C(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C24H43NO/c1-18(15-23(3,4)5)13-14-20(19(2)16-24(6,7)8)17-26-22-12-10-9-11-21(22)25/h9-12,18-20H,13-17,25H2,1-8H3 |
| InChIKey | HGQBRBXGVRFTTN-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.61 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|