C36H60OSi — CID 165167392
3-[2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctoxy]propyl-diphenyl-propan-2-ylsilane (PubChem CID 165167392) has the molecular formula C36H60OSi and a molecular weight of 536.96 g/mol. Its IUPAC name is 3-[2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctoxy]propyl-diphenyl-propan-2-ylsilane.
| Compound Name | 3-[2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctoxy]propyl-diphenyl-propan-2-ylsilane |
|---|---|
| PubChem CID | 165167392 |
| Molecular Formula | C36H60OSi |
| Molecular Weight | 536.96 g/mol |
| Exact Mass | 536.44 |
| IUPAC Name | 3-[2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctoxy]propyl-diphenyl-propan-2-ylsilane |
| SMILES | CC(CCC(COCCC[Si](c1ccccc1)(c1ccccc1)C(C)C)C(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C36H60OSi/c1-29(2)38(33-18-13-11-14-19-33,34-20-15-12-16-21-34)25-17-24-37-28-32(31(4)27-36(8,9)10)23-22-30(3)26-35(5,6)7/h11-16,18-21,29-32H,17,22-28H2,1-10H3 |
| InChIKey | VUUUQUUBVVLFHJ-UHFFFAOYSA-N |
| XLogP | 9.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.96 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|