C82H168N2 — CID 170153777
2,2,9,9-tetrakis[2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctyl]decane-1,10-diamine (PubChem CID 170153777) has the molecular formula C82H168N2 and a molecular weight of 1182.26 g/mol. Its IUPAC name is 2,2,9,9-tetrakis[2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctyl]decane-1,10-diamine.
| Compound Name | 2,2,9,9-tetrakis[2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctyl]decane-1,10-diamine |
|---|---|
| PubChem CID | 170153777 |
| Molecular Formula | C82H168N2 |
| Molecular Weight | 1182.26 g/mol |
| Exact Mass | 1181.32 |
| IUPAC Name | 2,2,9,9-tetrakis[2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctyl]decane-1,10-diamine |
| SMILES | CC(CCC(CC(CN)(CCCCCCC(CN)(CC(CCC(C)CC(C)(C)C)C(C)CC(C)(C)C)CC(CCC(C)CC(C)(C)C)C(C)CC(C)(C)C)CC(CCC(C)CC(C)(C)C)C(C)CC(C)(C)C)C(C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C82H168N2/c1-61(47-73(9,10)11)37-41-69(65(5)51-77(21,22)23)55-81(59-83,56-70(66(6)52-78(24,25)26)42-38-62(2)48-74(12,13)14)45-35-33-34-36-46-82(60-84,57-71(67(7)53-79(27,28)29)43-39-63(3)49-75(15,16)17)58-72(68(8)54-80(30,31)32)44-40-64(4)50-76(18,19)20/h61-72H,33-60,83-84H2,1-32H3 |
| InChIKey | UJETXOBATZZUOS-UHFFFAOYSA-N |
| XLogP | 26.94 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1182.26 |
| LogP ≤ 5 | 26.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|