C36H74O6PbS2 — CID 88793743
bis(2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctane-1-sulfonate);lead(2+) (PubChem CID 88793743) has the molecular formula C36H74O6PbS2 and a molecular weight of 874.32 g/mol. Its IUPAC name is bis(2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctane-1-sulfonate);lead(2+).
| Compound Name | bis(2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctane-1-sulfonate);lead(2+) |
|---|---|
| PubChem CID | 88793743 |
| Molecular Formula | C36H74O6PbS2 |
| Molecular Weight | 874.32 g/mol |
| Exact Mass | 874.47 |
| IUPAC Name | bis(2-(4,4-dimethylpentan-2-yl)-5,7,7-trimethyloctane-1-sulfonate);lead(2+) |
| SMILES | CC(CCC(CS(=O)(=O)[O-])C(C)CC(C)(C)C)CC(C)(C)C.CC(CCC(CS(=O)(=O)[O-])C(C)CC(C)(C)C)CC(C)(C)C.[Pb+2] |
| InChI | InChI=1S/2C18H38O3S.Pb/c2*1-14(11-17(3,4)5)9-10-16(13-22(19,20)21)15(2)12-18(6,7)8;/h2*14-16H,9-13H2,1-8H3,(H,19,20,21);/q;;+2/p-2 |
| InChIKey | WZMCBBXCHHPZLM-UHFFFAOYSA-L |
| XLogP | 9.76 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.32 |
| LogP ≤ 5 | 9.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|