C18H35O2- — CID 86308469
(2S,5S)-2-[(2S)-4,4-dimethylpentan-2-yl]-5,7,7-trimethyloctanoate (PubChem CID 86308469) has the molecular formula C18H35O2- and a molecular weight of 283.48 g/mol. Its IUPAC name is (2S,5S)-2-[(2S)-4,4-dimethylpentan-2-yl]-5,7,7-trimethyloctanoate.
| Compound Name | (2S,5S)-2-[(2S)-4,4-dimethylpentan-2-yl]-5,7,7-trimethyloctanoate |
|---|---|
| PubChem CID | 86308469 |
| Molecular Formula | C18H35O2- |
| Molecular Weight | 283.48 g/mol |
| Exact Mass | 283.26 |
| IUPAC Name | (2S,5S)-2-[(2S)-4,4-dimethylpentan-2-yl]-5,7,7-trimethyloctanoate |
| SMILES | C[C@@H](CC[C@H](C(=O)[O-])[C@@H](C)CC(C)(C)C)CC(C)(C)C |
| InChI | InChI=1S/C18H36O2/c1-13(11-17(3,4)5)9-10-15(16(19)20)14(2)12-18(6,7)8/h13-15H,9-12H2,1-8H3,(H,19,20)/p-1/t13-,14-,15-/m0/s1 |
| InChIKey | QBTIHZIVENIGSW-KKUMJFAQSA-M |
| XLogP | 4.28 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |