C22H20N2O4 — CID 4247588
4-[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]-4-phenylbutanoic acid (PubChem CID 4247588) has the molecular formula C22H20N2O4 and a molecular weight of 376.41 g/mol. Its IUPAC name is 4-[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]-4-phenylbutanoic acid.
| Compound Name | 4-[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 4247588 |
| Molecular Formula | C22H20N2O4 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 4-[(2-naphthalen-2-yloxyacetyl)hydrazinylidene]-4-phenylbutanoic acid |
| SMILES | O=C(O)CCC(=NNC(=O)COc1ccc2ccccc2c1)c1ccccc1 |
| InChI | InChI=1S/C22H20N2O4/c25-21(15-28-19-11-10-16-6-4-5-9-18(16)14-19)24-23-20(12-13-22(26)27)17-7-2-1-3-8-17/h1-11,14H,12-13,15H2,(H,24,25)(H,26,27) |
| InChIKey | IMYSVPWUZIMANN-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|