C21H23N3O5 — CID 3763980
4-[[2-[[2-(3-methylphenoxy)acetyl]amino]acetyl]hydrazinylidene]-4-phenylbutanoic acid (PubChem CID 3763980) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is 4-[[2-[[2-(3-methylphenoxy)acetyl]amino]acetyl]hydrazinylidene]-4-phenylbutanoic acid.
| Compound Name | 4-[[2-[[2-(3-methylphenoxy)acetyl]amino]acetyl]hydrazinylidene]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 3763980 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | 4-[[2-[[2-(3-methylphenoxy)acetyl]amino]acetyl]hydrazinylidene]-4-phenylbutanoic acid |
| SMILES | Cc1cccc(OCC(=O)NCC(=O)NN=C(CCC(=O)O)c2ccccc2)c1 |
| InChI | InChI=1S/C21H23N3O5/c1-15-6-5-9-17(12-15)29-14-20(26)22-13-19(25)24-23-18(10-11-21(27)28)16-7-3-2-4-8-16/h2-9,12H,10-11,13-14H2,1H3,(H,22,26)(H,24,25)(H,27,28) |
| InChIKey | AFQZRQXNPWDLIP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|