C23H27N3O3 — CID 46496046
2-[[2-(3-methylphenoxy)acetyl]amino]-N-[(E)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]acetamide (PubChem CID 46496046) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 2-[[2-(3-methylphenoxy)acetyl]amino]-N-[(E)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]acetamide.
| Compound Name | 2-[[2-(3-methylphenoxy)acetyl]amino]-N-[(E)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 46496046 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 2-[[2-(3-methylphenoxy)acetyl]amino]-N-[(E)-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethylideneamino]acetamide |
| SMILES | C/C(=N\NC(=O)CNC(=O)COc1cccc(C)c1)c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C23H27N3O3/c1-16-6-5-9-21(12-16)29-15-23(28)24-14-22(27)26-25-17(2)19-11-10-18-7-3-4-8-20(18)13-19/h5-6,9-13H,3-4,7-8,14-15H2,1-2H3,(H,24,28)(H,26,27)/b25-17+ |
| InChIKey | DASCKIBHTMIWMC-KOEQRZSOSA-N |
| XLogP | 2.91 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|