About 3-cyclopentyl-N,N-dipentylpropanamide
3-cyclopentyl-N,N-dipentylpropanamide (PubChem CID 4248024) has the molecular formula C18H35NO
and a molecular weight of 281.48 g/mol. Its IUPAC name is 3-cyclopentyl-N,N-dipentylpropanamide.
Molecular Properties
| Compound Name | 3-cyclopentyl-N,N-dipentylpropanamide |
| PubChem CID | 4248024 |
| Molecular Formula | C18H35NO |
| Molecular Weight | 281.48 g/mol |
| Exact Mass | 281.27 |
| IUPAC Name | 3-cyclopentyl-N,N-dipentylpropanamide |
| SMILES | CCCCCN(CCCCC)C(=O)CCC1CCCC1 |
| InChI | InChI=1S/C18H35NO/c1-3-5-9-15-19(16-10-6-4-2)18(20)14-13-17-11-7-8-12-17/h17H,3-16H2,1-2H3 |
| InChIKey | KLJJGRLSOQYCKL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 281.48 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopentyl-N,N-dipentylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentyl-N,N-dipentylpropanamide?
The IUPAC name of 3-cyclopentyl-N,N-dipentylpropanamide (CID 4248024) is 3-cyclopentyl-N,N-dipentylpropanamide.
What is the SMILES notation for 3-cyclopentyl-N,N-dipentylpropanamide?
The canonical SMILES for 3-cyclopentyl-N,N-dipentylpropanamide is CCCCCN(CCCCC)C(=O)CCC1CCCC1.
What is the InChIKey of 3-cyclopentyl-N,N-dipentylpropanamide?
The InChIKey is KLJJGRLSOQYCKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35NO/c1-3-5-9-15-19(16-10-6-4-2)18(20)14-13-17-11-7-8-12-17/h17H,3-16H2,1-2H3.
What are the key properties of 3-cyclopentyl-N,N-dipentylpropanamide?
3-cyclopentyl-N,N-dipentylpropanamide has a molecular weight of 281.48 g/mol, XLogP of 5.17, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentyl-N,N-dipentylpropanamide is sourced from PubChem (CID 4248024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).