About 3-cyclopentyl-N,N-diheptylpropanamide
3-cyclopentyl-N,N-diheptylpropanamide (PubChem CID 532988) has the molecular formula C22H43NO
and a molecular weight of 337.59 g/mol. Its IUPAC name is 3-cyclopentyl-N,N-diheptylpropanamide.
Molecular Properties
| Compound Name | 3-cyclopentyl-N,N-diheptylpropanamide |
| PubChem CID | 532988 |
| Molecular Formula | C22H43NO |
| Molecular Weight | 337.59 g/mol |
| Exact Mass | 337.33 |
| IUPAC Name | 3-cyclopentyl-N,N-diheptylpropanamide |
| SMILES | CCCCCCCN(CCCCCCC)C(=O)CCC1CCCC1 |
| InChI | InChI=1S/C22H43NO/c1-3-5-7-9-13-19-23(20-14-10-8-6-4-2)22(24)18-17-21-15-11-12-16-21/h21H,3-20H2,1-2H3 |
| InChIKey | XEVNPAKTLRPCEN-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 337.59 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopentyl-N,N-diheptylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentyl-N,N-diheptylpropanamide?
The IUPAC name of 3-cyclopentyl-N,N-diheptylpropanamide (CID 532988) is 3-cyclopentyl-N,N-diheptylpropanamide.
What is the SMILES notation for 3-cyclopentyl-N,N-diheptylpropanamide?
The canonical SMILES for 3-cyclopentyl-N,N-diheptylpropanamide is CCCCCCCN(CCCCCCC)C(=O)CCC1CCCC1.
What is the InChIKey of 3-cyclopentyl-N,N-diheptylpropanamide?
The InChIKey is XEVNPAKTLRPCEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H43NO/c1-3-5-7-9-13-19-23(20-14-10-8-6-4-2)22(24)18-17-21-15-11-12-16-21/h21H,3-20H2,1-2H3.
What are the key properties of 3-cyclopentyl-N,N-diheptylpropanamide?
3-cyclopentyl-N,N-diheptylpropanamide has a molecular weight of 337.59 g/mol, XLogP of 6.73, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentyl-N,N-diheptylpropanamide is sourced from PubChem (CID 532988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).