C27H21ClFN3O2S — CID 42486256
(8S)-8-[4-[(2-chlorophenyl)methoxy]phenyl]-3-(4-fluorophenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile (PubChem CID 42486256) has the molecular formula C27H21ClFN3O2S and a molecular weight of 506.00 g/mol. Its IUPAC name is (8S)-8-[4-[(2-chlorophenyl)methoxy]phenyl]-3-(4-fluorophenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile.
| Compound Name | (8S)-8-[4-[(2-chlorophenyl)methoxy]phenyl]-3-(4-fluorophenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
|---|---|
| PubChem CID | 42486256 |
| Molecular Formula | C27H21ClFN3O2S |
| Molecular Weight | 506.00 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | (8S)-8-[4-[(2-chlorophenyl)methoxy]phenyl]-3-(4-fluorophenyl)-6-oxo-2,4,7,8-tetrahydropyrido[2,1-b][1,3,5]thiadiazine-9-carbonitrile |
| SMILES | N#CC1=C2SCN(c3ccc(F)cc3)CN2C(=O)C[C@H]1c1ccc(OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C27H21ClFN3O2S/c28-25-4-2-1-3-19(25)15-34-22-11-5-18(6-12-22)23-13-26(33)32-16-31(17-35-27(32)24(23)14-30)21-9-7-20(29)8-10-21/h1-12,23H,13,15-17H2/t23-/m0/s1 |
| InChIKey | SGIBXMJYDAMCKV-QHCPKHFHSA-N |
| XLogP | 6.28 |
| TPSA | 56.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.00 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |