C16H20NOS2+ — CID 4249590
1-azoniabicyclo[2.2.2]octan-3-yl(dithiophen-2-yl)methanol (PubChem CID 4249590) has the molecular formula C16H20NOS2+ and a molecular weight of 306.48 g/mol. Its IUPAC name is 1-azoniabicyclo[2.2.2]octan-3-yl(dithiophen-2-yl)methanol.
| Compound Name | 1-azoniabicyclo[2.2.2]octan-3-yl(dithiophen-2-yl)methanol |
|---|---|
| PubChem CID | 4249590 |
| Molecular Formula | C16H20NOS2+ |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 1-azoniabicyclo[2.2.2]octan-3-yl(dithiophen-2-yl)methanol |
| SMILES | OC(c1cccs1)(c1cccs1)C1C[NH+]2CCC1CC2 |
| InChI | InChI=1S/C16H19NOS2/c18-16(14-3-1-9-19-14,15-4-2-10-20-15)13-11-17-7-5-12(13)6-8-17/h1-4,9-10,12-13,18H,5-8,11H2/p+1 |
| InChIKey | CTYCSOSPTSAGHP-UHFFFAOYSA-O |
| XLogP | 1.97 |
| TPSA | 24.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |