C25H26N2O5S — CID 42497669
(3R,7S)-3-(3,4-dimethoxyphenyl)-3-hydroxy-5-oxo-7-(4-propan-2-yloxyphenyl)-6,7-dihydro-2H-[1,3]thiazolo[3,2-a]pyridine-8-carbonitrile (PubChem CID 42497669) has the molecular formula C25H26N2O5S and a molecular weight of 466.56 g/mol. Its IUPAC name is (3R,7S)-3-(3,4-dimethoxyphenyl)-3-hydroxy-5-oxo-7-(4-propan-2-yloxyphenyl)-6,7-dihydro-2H-[1,3]thiazolo[3,2-a]pyridine-8-carbonitrile.
| Compound Name | (3R,7S)-3-(3,4-dimethoxyphenyl)-3-hydroxy-5-oxo-7-(4-propan-2-yloxyphenyl)-6,7-dihydro-2H-[1,3]thiazolo[3,2-a]pyridine-8-carbonitrile |
|---|---|
| PubChem CID | 42497669 |
| Molecular Formula | C25H26N2O5S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | (3R,7S)-3-(3,4-dimethoxyphenyl)-3-hydroxy-5-oxo-7-(4-propan-2-yloxyphenyl)-6,7-dihydro-2H-[1,3]thiazolo[3,2-a]pyridine-8-carbonitrile |
| SMILES | COc1ccc([C@@]2(O)CSC3=C(C#N)[C@H](c4ccc(OC(C)C)cc4)CC(=O)N32)cc1OC |
| InChI | InChI=1S/C25H26N2O5S/c1-15(2)32-18-8-5-16(6-9-18)19-12-23(28)27-24(20(19)13-26)33-14-25(27,29)17-7-10-21(30-3)22(11-17)31-4/h5-11,15,19,29H,12,14H2,1-4H3/t19-,25-/m0/s1 |
| InChIKey | QWJFETKSNJIQSF-DFBJGRDBSA-N |
| XLogP | 4.13 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |