C24H24N2O6S — CID 42497917
(3R,7S)-7-(2,5-dimethoxyphenyl)-3-(3,4-dimethoxyphenyl)-3-hydroxy-5-oxo-6,7-dihydro-2H-[1,3]thiazolo[3,2-a]pyridine-8-carbonitrile (PubChem CID 42497917) has the molecular formula C24H24N2O6S and a molecular weight of 468.53 g/mol. Its IUPAC name is (3R,7S)-7-(2,5-dimethoxyphenyl)-3-(3,4-dimethoxyphenyl)-3-hydroxy-5-oxo-6,7-dihydro-2H-[1,3]thiazolo[3,2-a]pyridine-8-carbonitrile.
| Compound Name | (3R,7S)-7-(2,5-dimethoxyphenyl)-3-(3,4-dimethoxyphenyl)-3-hydroxy-5-oxo-6,7-dihydro-2H-[1,3]thiazolo[3,2-a]pyridine-8-carbonitrile |
|---|---|
| PubChem CID | 42497917 |
| Molecular Formula | C24H24N2O6S |
| Molecular Weight | 468.53 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | (3R,7S)-7-(2,5-dimethoxyphenyl)-3-(3,4-dimethoxyphenyl)-3-hydroxy-5-oxo-6,7-dihydro-2H-[1,3]thiazolo[3,2-a]pyridine-8-carbonitrile |
| SMILES | COc1ccc(OC)c([C@@H]2CC(=O)N3C(=C2C#N)SC[C@]3(O)c2ccc(OC)c(OC)c2)c1 |
| InChI | InChI=1S/C24H24N2O6S/c1-29-15-6-8-19(30-2)17(10-15)16-11-22(27)26-23(18(16)12-25)33-13-24(26,28)14-5-7-20(31-3)21(9-14)32-4/h5-10,16,28H,11,13H2,1-4H3/t16-,24-/m0/s1 |
| InChIKey | LLIATVXWSXRXTK-FYSMJZIKSA-N |
| XLogP | 3.36 |
| TPSA | 101.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.53 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |