C22H19ClN2O4S — CID 42497923
(3S,7S)-3-(4-chlorophenyl)-7-(2,5-dimethoxyphenyl)-3-hydroxy-5-oxo-6,7-dihydro-2H-[1,3]thiazolo[3,2-a]pyridine-8-carbonitrile (PubChem CID 42497923) has the molecular formula C22H19ClN2O4S and a molecular weight of 442.92 g/mol. Its IUPAC name is (3S,7S)-3-(4-chlorophenyl)-7-(2,5-dimethoxyphenyl)-3-hydroxy-5-oxo-6,7-dihydro-2H-[1,3]thiazolo[3,2-a]pyridine-8-carbonitrile.
| Compound Name | (3S,7S)-3-(4-chlorophenyl)-7-(2,5-dimethoxyphenyl)-3-hydroxy-5-oxo-6,7-dihydro-2H-[1,3]thiazolo[3,2-a]pyridine-8-carbonitrile |
|---|---|
| PubChem CID | 42497923 |
| Molecular Formula | C22H19ClN2O4S |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 442.08 |
| IUPAC Name | (3S,7S)-3-(4-chlorophenyl)-7-(2,5-dimethoxyphenyl)-3-hydroxy-5-oxo-6,7-dihydro-2H-[1,3]thiazolo[3,2-a]pyridine-8-carbonitrile |
| SMILES | COc1ccc(OC)c([C@@H]2CC(=O)N3C(=C2C#N)SC[C@@]3(O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C22H19ClN2O4S/c1-28-15-7-8-19(29-2)17(9-15)16-10-20(26)25-21(18(16)11-24)30-12-22(25,27)13-3-5-14(23)6-4-13/h3-9,16,27H,10,12H2,1-2H3/t16-,22+/m0/s1 |
| InChIKey | ZABQWNSAWBCAIL-KSFYIVLOSA-N |
| XLogP | 4.00 |
| TPSA | 82.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |