C24H25N3O5 — CID 42500950
3-N-[(4-methoxyphenyl)methyl]-1-[(5-methylfuran-2-yl)methyl]-4-oxo-5-N-prop-2-enylpyridine-3,5-dicarboxamide (PubChem CID 42500950) has the molecular formula C24H25N3O5 and a molecular weight of 435.48 g/mol. Its IUPAC name is 3-N-[(4-methoxyphenyl)methyl]-1-[(5-methylfuran-2-yl)methyl]-4-oxo-5-N-prop-2-enylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N-[(4-methoxyphenyl)methyl]-1-[(5-methylfuran-2-yl)methyl]-4-oxo-5-N-prop-2-enylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 42500950 |
| Molecular Formula | C24H25N3O5 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | 3-N-[(4-methoxyphenyl)methyl]-1-[(5-methylfuran-2-yl)methyl]-4-oxo-5-N-prop-2-enylpyridine-3,5-dicarboxamide |
| SMILES | C=CCNC(=O)c1cn(Cc2ccc(C)o2)cc(C(=O)NCc2ccc(OC)cc2)c1=O |
| InChI | InChI=1S/C24H25N3O5/c1-4-11-25-23(29)20-14-27(13-19-8-5-16(2)32-19)15-21(22(20)28)24(30)26-12-17-6-9-18(31-3)10-7-17/h4-10,14-15H,1,11-13H2,2-3H3,(H,25,29)(H,26,30) |
| InChIKey | VRXCSVXZOKAULK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|