C23H23N3O4 — CID 26397434
1-benzyl-3-N-[(5-methylfuran-2-yl)methyl]-4-oxo-5-N-prop-2-enylpyridine-3,5-dicarboxamide (PubChem CID 26397434) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is 1-benzyl-3-N-[(5-methylfuran-2-yl)methyl]-4-oxo-5-N-prop-2-enylpyridine-3,5-dicarboxamide.
| Compound Name | 1-benzyl-3-N-[(5-methylfuran-2-yl)methyl]-4-oxo-5-N-prop-2-enylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 26397434 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 1-benzyl-3-N-[(5-methylfuran-2-yl)methyl]-4-oxo-5-N-prop-2-enylpyridine-3,5-dicarboxamide |
| SMILES | C=CCNC(=O)c1cn(Cc2ccccc2)cc(C(=O)NCc2ccc(C)o2)c1=O |
| InChI | InChI=1S/C23H23N3O4/c1-3-11-24-22(28)19-14-26(13-17-7-5-4-6-8-17)15-20(21(19)27)23(29)25-12-18-10-9-16(2)30-18/h3-10,14-15H,1,11-13H2,2H3,(H,24,28)(H,25,29) |
| InChIKey | DBDNQJIAYSDHHT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|