C25H26N4O3 — CID 118758455
3-N-[(4-methylphenyl)methyl]-4-oxo-5-N-prop-2-enyl-1-(2-pyridin-2-ylethyl)pyridine-3,5-dicarboxamide (PubChem CID 118758455) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 3-N-[(4-methylphenyl)methyl]-4-oxo-5-N-prop-2-enyl-1-(2-pyridin-2-ylethyl)pyridine-3,5-dicarboxamide.
| Compound Name | 3-N-[(4-methylphenyl)methyl]-4-oxo-5-N-prop-2-enyl-1-(2-pyridin-2-ylethyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 118758455 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 3-N-[(4-methylphenyl)methyl]-4-oxo-5-N-prop-2-enyl-1-(2-pyridin-2-ylethyl)pyridine-3,5-dicarboxamide |
| SMILES | C=CCNC(=O)c1cn(CCc2ccccn2)cc(C(=O)NCc2ccc(C)cc2)c1=O |
| InChI | InChI=1S/C25H26N4O3/c1-3-12-27-24(31)21-16-29(14-11-20-6-4-5-13-26-20)17-22(23(21)30)25(32)28-15-19-9-7-18(2)8-10-19/h3-10,13,16-17H,1,11-12,14-15H2,2H3,(H,27,31)(H,28,32) |
| InChIKey | CZGVSNVDVHVXCM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|