C22H27N3O4 — CID 56858912
3-N-cyclohexyl-1-[(5-methylfuran-2-yl)methyl]-4-oxo-5-N-prop-2-enylpyridine-3,5-dicarboxamide (PubChem CID 56858912) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is 3-N-cyclohexyl-1-[(5-methylfuran-2-yl)methyl]-4-oxo-5-N-prop-2-enylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N-cyclohexyl-1-[(5-methylfuran-2-yl)methyl]-4-oxo-5-N-prop-2-enylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 56858912 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | 3-N-cyclohexyl-1-[(5-methylfuran-2-yl)methyl]-4-oxo-5-N-prop-2-enylpyridine-3,5-dicarboxamide |
| SMILES | C=CCNC(=O)c1cn(Cc2ccc(C)o2)cc(C(=O)NC2CCCCC2)c1=O |
| InChI | InChI=1S/C22H27N3O4/c1-3-11-23-21(27)18-13-25(12-17-10-9-15(2)29-17)14-19(20(18)26)22(28)24-16-7-5-4-6-8-16/h3,9-10,13-14,16H,1,4-8,11-12H2,2H3,(H,23,27)(H,24,28) |
| InChIKey | OTPKJPQUDDRWRX-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 93.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|