C23H29FN2O2 — CID 42501309
(2S)-N-[2-(cyclohexen-1-yl)ethyl]-6-(4-fluorobenzoyl)-6-azaspiro[2.5]octane-2-carboxamide (PubChem CID 42501309) has the molecular formula C23H29FN2O2 and a molecular weight of 384.50 g/mol. Its IUPAC name is (2S)-N-[2-(cyclohexen-1-yl)ethyl]-6-(4-fluorobenzoyl)-6-azaspiro[2.5]octane-2-carboxamide.
| Compound Name | (2S)-N-[2-(cyclohexen-1-yl)ethyl]-6-(4-fluorobenzoyl)-6-azaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 42501309 |
| Molecular Formula | C23H29FN2O2 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | (2S)-N-[2-(cyclohexen-1-yl)ethyl]-6-(4-fluorobenzoyl)-6-azaspiro[2.5]octane-2-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)[C@H]1CC12CCN(C(=O)c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C23H29FN2O2/c24-19-8-6-18(7-9-19)22(28)26-14-11-23(12-15-26)16-20(23)21(27)25-13-10-17-4-2-1-3-5-17/h4,6-9,20H,1-3,5,10-16H2,(H,25,27)/t20-/m1/s1 |
| InChIKey | GDMJHXUYKKAMAG-HXUWFJFHSA-N |
| XLogP | 4.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|