C23H30N4OS — CID 45226153
6-(2,1,3-benzothiadiazol-5-ylmethyl)-N-[2-(cyclohexen-1-yl)ethyl]-6-azaspiro[2.5]octane-2-carboxamide (PubChem CID 45226153) has the molecular formula C23H30N4OS and a molecular weight of 410.59 g/mol. Its IUPAC name is 6-(2,1,3-benzothiadiazol-5-ylmethyl)-N-[2-(cyclohexen-1-yl)ethyl]-6-azaspiro[2.5]octane-2-carboxamide.
| Compound Name | 6-(2,1,3-benzothiadiazol-5-ylmethyl)-N-[2-(cyclohexen-1-yl)ethyl]-6-azaspiro[2.5]octane-2-carboxamide |
|---|---|
| PubChem CID | 45226153 |
| Molecular Formula | C23H30N4OS |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 6-(2,1,3-benzothiadiazol-5-ylmethyl)-N-[2-(cyclohexen-1-yl)ethyl]-6-azaspiro[2.5]octane-2-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)C1CC12CCN(Cc1ccc3nsnc3c1)CC2 |
| InChI | InChI=1S/C23H30N4OS/c28-22(24-11-8-17-4-2-1-3-5-17)19-15-23(19)9-12-27(13-10-23)16-18-6-7-20-21(14-18)26-29-25-20/h4,6-7,14,19H,1-3,5,8-13,15-16H2,(H,24,28) |
| InChIKey | KFJPQUYALCKDMT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|