C20H28N2O2 — CID 42501749
1-[[(1R)-cyclohex-3-en-1-yl]methyl]-4-(2-phenoxyethyl)-1,4-diazepan-5-one (PubChem CID 42501749) has the molecular formula C20H28N2O2 and a molecular weight of 328.46 g/mol. Its IUPAC name is 1-[[(1R)-cyclohex-3-en-1-yl]methyl]-4-(2-phenoxyethyl)-1,4-diazepan-5-one.
| Compound Name | 1-[[(1R)-cyclohex-3-en-1-yl]methyl]-4-(2-phenoxyethyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 42501749 |
| Molecular Formula | C20H28N2O2 |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.22 |
| IUPAC Name | 1-[[(1R)-cyclohex-3-en-1-yl]methyl]-4-(2-phenoxyethyl)-1,4-diazepan-5-one |
| SMILES | O=C1CCN(C[C@H]2CC=CCC2)CCN1CCOc1ccccc1 |
| InChI | InChI=1S/C20H28N2O2/c23-20-11-12-21(17-18-7-3-1-4-8-18)13-14-22(20)15-16-24-19-9-5-2-6-10-19/h1-3,5-6,9-10,18H,4,7-8,11-17H2/t18-/m0/s1 |
| InChIKey | MIEQWOQBFKOGGH-SFHVURJKSA-N |
| XLogP | 2.96 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|