C26H23BrClN3O2S — CID 4250466
10-(4-bromophenyl)-4-chloro-N-(2,4-dimethylphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide (PubChem CID 4250466) has the molecular formula C26H23BrClN3O2S and a molecular weight of 556.91 g/mol. Its IUPAC name is 10-(4-bromophenyl)-4-chloro-N-(2,4-dimethylphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide.
| Compound Name | 10-(4-bromophenyl)-4-chloro-N-(2,4-dimethylphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
|---|---|
| PubChem CID | 4250466 |
| Molecular Formula | C26H23BrClN3O2S |
| Molecular Weight | 556.91 g/mol |
| Exact Mass | 555.04 |
| IUPAC Name | 10-(4-bromophenyl)-4-chloro-N-(2,4-dimethylphenyl)-9-methyl-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2C3NC(=S)N(c4ccc(Br)cc4)C2(C)Oc2ccc(Cl)cc23)c(C)c1 |
| InChI | InChI=1S/C26H23BrClN3O2S/c1-14-4-10-20(15(2)12-14)29-24(32)22-23-19-13-17(28)7-11-21(19)33-26(22,3)31(25(34)30-23)18-8-5-16(27)6-9-18/h4-13,22-23H,1-3H3,(H,29,32)(H,30,34) |
| InChIKey | XAGMBTDDAOHRSP-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.91 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|