C27H26BrN3O2S — CID 99947595
(1R,9S,13S)-4-bromo-N-(2,4-dimethylphenyl)-9-methyl-10-(3-methylphenyl)-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide (PubChem CID 99947595) has the molecular formula C27H26BrN3O2S and a molecular weight of 536.50 g/mol. Its IUPAC name is (1R,9S,13S)-4-bromo-N-(2,4-dimethylphenyl)-9-methyl-10-(3-methylphenyl)-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide.
| Compound Name | (1R,9S,13S)-4-bromo-N-(2,4-dimethylphenyl)-9-methyl-10-(3-methylphenyl)-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
|---|---|
| PubChem CID | 99947595 |
| Molecular Formula | C27H26BrN3O2S |
| Molecular Weight | 536.50 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | (1R,9S,13S)-4-bromo-N-(2,4-dimethylphenyl)-9-methyl-10-(3-methylphenyl)-11-sulfanylidene-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene-13-carboxamide |
| SMILES | Cc1cccc(N2C(=S)N[C@H]3c4cc(Br)ccc4O[C@@]2(C)[C@H]3C(=O)Nc2ccc(C)cc2C)c1 |
| InChI | InChI=1S/C27H26BrN3O2S/c1-15-6-5-7-19(13-15)31-26(34)30-24-20-14-18(28)9-11-22(20)33-27(31,4)23(24)25(32)29-21-10-8-16(2)12-17(21)3/h5-14,23-24H,1-4H3,(H,29,32)(H,30,34)/t23-,24+,27+/m1/s1 |
| InChIKey | ZFZLEDNXMIVURC-DXBVXKBHSA-N |
| XLogP | 6.17 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.50 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|