C18H31N3O3S — CID 42514858
(3S)-1-[(3-butyl-2-cyclohexylsulfonylimidazol-4-yl)methyl]pyrrolidin-3-ol (PubChem CID 42514858) has the molecular formula C18H31N3O3S and a molecular weight of 369.53 g/mol. Its IUPAC name is (3S)-1-[(3-butyl-2-cyclohexylsulfonylimidazol-4-yl)methyl]pyrrolidin-3-ol.
| Compound Name | (3S)-1-[(3-butyl-2-cyclohexylsulfonylimidazol-4-yl)methyl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 42514858 |
| Molecular Formula | C18H31N3O3S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | (3S)-1-[(3-butyl-2-cyclohexylsulfonylimidazol-4-yl)methyl]pyrrolidin-3-ol |
| SMILES | CCCCn1c(CN2CC[C@H](O)C2)cnc1S(=O)(=O)C1CCCCC1 |
| InChI | InChI=1S/C18H31N3O3S/c1-2-3-10-21-15(13-20-11-9-16(22)14-20)12-19-18(21)25(23,24)17-7-5-4-6-8-17/h12,16-17,22H,2-11,13-14H2,1H3/t16-/m0/s1 |
| InChIKey | SAUBDSHCDZGEBV-INIZCTEOSA-N |
| XLogP | 2.36 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |