C20H21ClO3S — CID 4251978
4-(4-tert-butylphenyl)-2-(4-chlorophenyl)sulfanyl-4-oxobutanoic acid (PubChem CID 4251978) has the molecular formula C20H21ClO3S and a molecular weight of 376.91 g/mol. Its IUPAC name is 4-(4-tert-butylphenyl)-2-(4-chlorophenyl)sulfanyl-4-oxobutanoic acid.
| Compound Name | 4-(4-tert-butylphenyl)-2-(4-chlorophenyl)sulfanyl-4-oxobutanoic acid |
|---|---|
| PubChem CID | 4251978 |
| Molecular Formula | C20H21ClO3S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 4-(4-tert-butylphenyl)-2-(4-chlorophenyl)sulfanyl-4-oxobutanoic acid |
| SMILES | CC(C)(C)c1ccc(C(=O)CC(Sc2ccc(Cl)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C20H21ClO3S/c1-20(2,3)14-6-4-13(5-7-14)17(22)12-18(19(23)24)25-16-10-8-15(21)9-11-16/h4-11,18H,12H2,1-3H3,(H,23,24) |
| InChIKey | LWFKAUBYCJNQTD-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |