C21H36N4O3S — CID 42520757
[1-[(3-butyl-2-ethylsulfonylimidazol-4-yl)methyl]piperidin-4-yl]-piperidin-1-ylmethanone (PubChem CID 42520757) has the molecular formula C21H36N4O3S and a molecular weight of 424.61 g/mol. Its IUPAC name is [1-[(3-butyl-2-ethylsulfonylimidazol-4-yl)methyl]piperidin-4-yl]-piperidin-1-ylmethanone.
| Compound Name | [1-[(3-butyl-2-ethylsulfonylimidazol-4-yl)methyl]piperidin-4-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 42520757 |
| Molecular Formula | C21H36N4O3S |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | [1-[(3-butyl-2-ethylsulfonylimidazol-4-yl)methyl]piperidin-4-yl]-piperidin-1-ylmethanone |
| SMILES | CCCCn1c(CN2CCC(C(=O)N3CCCCC3)CC2)cnc1S(=O)(=O)CC |
| InChI | InChI=1S/C21H36N4O3S/c1-3-5-13-25-19(16-22-21(25)29(27,28)4-2)17-23-14-9-18(10-15-23)20(26)24-11-7-6-8-12-24/h16,18H,3-15,17H2,1-2H3 |
| InChIKey | VCZOYCGKUAAGRW-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |