C23H21N7O3 — CID 42523097
[2-[4-(3-phenyltriazolo[4,5-d]pyrimidin-7-yl)piperazine-1-carbonyl]phenyl] acetate (PubChem CID 42523097) has the molecular formula C23H21N7O3 and a molecular weight of 443.47 g/mol. Its IUPAC name is [2-[4-(3-phenyltriazolo[4,5-d]pyrimidin-7-yl)piperazine-1-carbonyl]phenyl] acetate.
| Compound Name | [2-[4-(3-phenyltriazolo[4,5-d]pyrimidin-7-yl)piperazine-1-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 42523097 |
| Molecular Formula | C23H21N7O3 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.17 |
| IUPAC Name | [2-[4-(3-phenyltriazolo[4,5-d]pyrimidin-7-yl)piperazine-1-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1C(=O)N1CCN(c2ncnc3c2nnn3-c2ccccc2)CC1 |
| InChI | InChI=1S/C23H21N7O3/c1-16(31)33-19-10-6-5-9-18(19)23(32)29-13-11-28(12-14-29)21-20-22(25-15-24-21)30(27-26-20)17-7-3-2-4-8-17/h2-10,15H,11-14H2,1H3 |
| InChIKey | JEDFSDSRMHVTDM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 106.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|