C29H30N4O3S — CID 42524206
(E)-2-cyano-3-(4-ethoxyanilino)-N-(2-methylphenyl)-3-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]sulfanylprop-2-enamide (PubChem CID 42524206) has the molecular formula C29H30N4O3S and a molecular weight of 514.65 g/mol. Its IUPAC name is (E)-2-cyano-3-(4-ethoxyanilino)-N-(2-methylphenyl)-3-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]sulfanylprop-2-enamide.
| Compound Name | (E)-2-cyano-3-(4-ethoxyanilino)-N-(2-methylphenyl)-3-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]sulfanylprop-2-enamide |
|---|---|
| PubChem CID | 42524206 |
| Molecular Formula | C29H30N4O3S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | (E)-2-cyano-3-(4-ethoxyanilino)-N-(2-methylphenyl)-3-[2-oxo-2-[[(1S)-1-phenylethyl]amino]ethyl]sulfanylprop-2-enamide |
| SMILES | CCOc1ccc(N/C(SCC(=O)N[C@@H](C)c2ccccc2)=C(/C#N)C(=O)Nc2ccccc2C)cc1 |
| InChI | InChI=1S/C29H30N4O3S/c1-4-36-24-16-14-23(15-17-24)32-29(25(18-30)28(35)33-26-13-9-8-10-20(26)2)37-19-27(34)31-21(3)22-11-6-5-7-12-22/h5-17,21,32H,4,19H2,1-3H3,(H,31,34)(H,33,35)/b29-25+/t21-/m0/s1 |
| InChIKey | YGPKDALKECZGDE-PDKRQQHWSA-N |
| XLogP | 5.79 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|