C24H25ClN2O3 — CID 42525468
(1S,5S,7S)-3-[(3-chlorophenyl)methyl]-7-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one (PubChem CID 42525468) has the molecular formula C24H25ClN2O3 and a molecular weight of 424.93 g/mol. Its IUPAC name is (1S,5S,7S)-3-[(3-chlorophenyl)methyl]-7-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one.
| Compound Name | (1S,5S,7S)-3-[(3-chlorophenyl)methyl]-7-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one |
|---|---|
| PubChem CID | 42525468 |
| Molecular Formula | C24H25ClN2O3 |
| Molecular Weight | 424.93 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | (1S,5S,7S)-3-[(3-chlorophenyl)methyl]-7-(2,3-dihydro-1,4-benzodioxin-6-yl)-3,8-diazatricyclo[6.3.0.01,5]undecan-2-one |
| SMILES | O=C1N(Cc2cccc(Cl)c2)C[C@@H]2C[C@@H](c3ccc4c(c3)OCCO4)N3CCC[C@@]123 |
| InChI | InChI=1S/C24H25ClN2O3/c25-19-4-1-3-16(11-19)14-26-15-18-13-20(27-8-2-7-24(18,27)23(26)28)17-5-6-21-22(12-17)30-10-9-29-21/h1,3-6,11-12,18,20H,2,7-10,13-15H2/t18-,20-,24-/m0/s1 |
| InChIKey | JOJUGLXKHAXDGC-WXVUKLJWSA-N |
| XLogP | 4.05 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.93 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |