C22H34ClN3O2 — CID 42526692
3-[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-4-yl]-N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]propanamide (PubChem CID 42526692) has the molecular formula C22H34ClN3O2 and a molecular weight of 407.99 g/mol. Its IUPAC name is 3-[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-4-yl]-N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]propanamide.
| Compound Name | 3-[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-4-yl]-N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]propanamide |
|---|---|
| PubChem CID | 42526692 |
| Molecular Formula | C22H34ClN3O2 |
| Molecular Weight | 407.99 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | 3-[1-[(5-chloro-2-hydroxyphenyl)methyl]piperidin-4-yl]-N-[[(2R)-1-ethylpyrrolidin-2-yl]methyl]propanamide |
| SMILES | CCN1CCC[C@@H]1CNC(=O)CCC1CCN(Cc2cc(Cl)ccc2O)CC1 |
| InChI | InChI=1S/C22H34ClN3O2/c1-2-26-11-3-4-20(26)15-24-22(28)8-5-17-9-12-25(13-10-17)16-18-14-19(23)6-7-21(18)27/h6-7,14,17,20,27H,2-5,8-13,15-16H2,1H3,(H,24,28)/t20-/m1/s1 |
| InChIKey | XAWXLYBIUBJQSI-HXUWFJFHSA-N |
| XLogP | 3.64 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.99 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|