C20H22FNO3S — CID 42527567
[(3R)-1-ethylsulfonylpiperidin-3-yl]-(3-fluoro-4-phenylphenyl)methanone (PubChem CID 42527567) has the molecular formula C20H22FNO3S and a molecular weight of 375.47 g/mol. Its IUPAC name is [(3R)-1-ethylsulfonylpiperidin-3-yl]-(3-fluoro-4-phenylphenyl)methanone.
| Compound Name | [(3R)-1-ethylsulfonylpiperidin-3-yl]-(3-fluoro-4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 42527567 |
| Molecular Formula | C20H22FNO3S |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [(3R)-1-ethylsulfonylpiperidin-3-yl]-(3-fluoro-4-phenylphenyl)methanone |
| SMILES | CCS(=O)(=O)N1CCC[C@@H](C(=O)c2ccc(-c3ccccc3)c(F)c2)C1 |
| InChI | InChI=1S/C20H22FNO3S/c1-2-26(24,25)22-12-6-9-17(14-22)20(23)16-10-11-18(19(21)13-16)15-7-4-3-5-8-15/h3-5,7-8,10-11,13,17H,2,6,9,12,14H2,1H3/t17-/m1/s1 |
| InChIKey | RYERUMBYPAOFAP-QGZVFWFLSA-N |
| XLogP | 3.74 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |