C21H26N4O4S — CID 42539055
ethyl 1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-[(3-methoxypropylamino)methyl]pyrazole-4-carboxylate (PubChem CID 42539055) has the molecular formula C21H26N4O4S and a molecular weight of 430.53 g/mol. Its IUPAC name is ethyl 1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-[(3-methoxypropylamino)methyl]pyrazole-4-carboxylate.
| Compound Name | ethyl 1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-[(3-methoxypropylamino)methyl]pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 42539055 |
| Molecular Formula | C21H26N4O4S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | ethyl 1-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]-5-[(3-methoxypropylamino)methyl]pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1cnn(-c2nc(-c3ccc(OC)cc3)cs2)c1CNCCCOC |
| InChI | InChI=1S/C21H26N4O4S/c1-4-29-20(26)17-12-23-25(19(17)13-22-10-5-11-27-2)21-24-18(14-30-21)15-6-8-16(28-3)9-7-15/h6-9,12,14,22H,4-5,10-11,13H2,1-3H3 |
| InChIKey | PWPDGZJWMVYTAO-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|