C16H11N5OS — CID 42545433
N-(3-methylcinnolin-5-yl)-2,1,3-benzothiadiazole-4-carboxamide (PubChem CID 42545433) has the molecular formula C16H11N5OS and a molecular weight of 321.37 g/mol. Its IUPAC name is N-(3-methylcinnolin-5-yl)-2,1,3-benzothiadiazole-4-carboxamide.
| Compound Name | N-(3-methylcinnolin-5-yl)-2,1,3-benzothiadiazole-4-carboxamide |
|---|---|
| PubChem CID | 42545433 |
| Molecular Formula | C16H11N5OS |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | N-(3-methylcinnolin-5-yl)-2,1,3-benzothiadiazole-4-carboxamide |
| SMILES | Cc1cc2c(NC(=O)c3cccc4nsnc34)cccc2nn1 |
| InChI | InChI=1S/C16H11N5OS/c1-9-8-11-12(5-3-6-13(11)19-18-9)17-16(22)10-4-2-7-14-15(10)21-23-20-14/h2-8H,1H3,(H,17,22) |
| InChIKey | VKIMIOZIQHJDDF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |