C22H28N4O2 — CID 42548500
(4S)-4-[4-(diethylamino)phenyl]-7,7-dimethyl-1,2,4,6,8,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione (PubChem CID 42548500) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is (4S)-4-[4-(diethylamino)phenyl]-7,7-dimethyl-1,2,4,6,8,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione.
| Compound Name | (4S)-4-[4-(diethylamino)phenyl]-7,7-dimethyl-1,2,4,6,8,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione |
|---|---|
| PubChem CID | 42548500 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | (4S)-4-[4-(diethylamino)phenyl]-7,7-dimethyl-1,2,4,6,8,9-hexahydropyrazolo[3,4-b]quinoline-3,5-dione |
| SMILES | CCN(CC)c1ccc([C@H]2C3=C(CC(C)(C)CC3=O)Nc3[nH][nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C22H28N4O2/c1-5-26(6-2)14-9-7-13(8-10-14)17-18-15(11-22(3,4)12-16(18)27)23-20-19(17)21(28)25-24-20/h7-10,17H,5-6,11-12H2,1-4H3,(H3,23,24,25,28)/t17-/m0/s1 |
| InChIKey | FXDUFQLVMHYMAL-KRWDZBQOSA-N |
| XLogP | 3.75 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |