C14H20FN5O4 — CID 42553034
(2R,3S,4R,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-(hydroxymethyl)-2,3,4,5-tetramethyloxolane-3,4-diol (PubChem CID 42553034) has the molecular formula C14H20FN5O4 and a molecular weight of 341.34 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-(hydroxymethyl)-2,3,4,5-tetramethyloxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-(hydroxymethyl)-2,3,4,5-tetramethyloxolane-3,4-diol |
|---|---|
| PubChem CID | 42553034 |
| Molecular Formula | C14H20FN5O4 |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | (2R,3S,4R,5R)-2-(6-amino-2-fluoropurin-9-yl)-5-(hydroxymethyl)-2,3,4,5-tetramethyloxolane-3,4-diol |
| SMILES | C[C@]1(O)[C@@](C)(O)[C@@](C)(CO)O[C@@]1(C)n1cnc2c(N)nc(F)nc21 |
| InChI | InChI=1S/C14H20FN5O4/c1-11(5-21)12(2,22)13(3,23)14(4,24-11)20-6-17-7-8(16)18-10(15)19-9(7)20/h6,21-23H,5H2,1-4H3,(H2,16,18,19)/t11-,12+,13+,14-/m1/s1 |
| InChIKey | AWHYHMJLISBZQX-ZOBORPQBSA-N |
| XLogP | -0.50 |
| TPSA | 139.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |