C27H20N4O5 — CID 42553669
(4S)-4-(1,3-benzodioxol-5-yl)-1-(4-nitrophenyl)-5-oxo-2-pyrrol-1-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 42553669) has the molecular formula C27H20N4O5 and a molecular weight of 480.48 g/mol. Its IUPAC name is (4S)-4-(1,3-benzodioxol-5-yl)-1-(4-nitrophenyl)-5-oxo-2-pyrrol-1-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | (4S)-4-(1,3-benzodioxol-5-yl)-1-(4-nitrophenyl)-5-oxo-2-pyrrol-1-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 42553669 |
| Molecular Formula | C27H20N4O5 |
| Molecular Weight | 480.48 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | (4S)-4-(1,3-benzodioxol-5-yl)-1-(4-nitrophenyl)-5-oxo-2-pyrrol-1-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | N#CC1=C(n2cccc2)N(c2ccc([N+](=O)[O-])cc2)C2=C(C(=O)CCC2)[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H20N4O5/c28-15-20-25(17-6-11-23-24(14-17)36-16-35-23)26-21(4-3-5-22(26)32)30(27(20)29-12-1-2-13-29)18-7-9-19(10-8-18)31(33)34/h1-2,6-14,25H,3-5,16H2/t25-/m0/s1 |
| InChIKey | XICMSKDDRKBPES-VWLOTQADSA-N |
| XLogP | 5.13 |
| TPSA | 110.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.48 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|