C27H19ClN4O5 — CID 42553672
(4R)-4-(1,3-benzodioxol-5-yl)-1-(2-chloro-4-nitrophenyl)-5-oxo-2-pyrrol-1-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 42553672) has the molecular formula C27H19ClN4O5 and a molecular weight of 514.93 g/mol. Its IUPAC name is (4R)-4-(1,3-benzodioxol-5-yl)-1-(2-chloro-4-nitrophenyl)-5-oxo-2-pyrrol-1-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | (4R)-4-(1,3-benzodioxol-5-yl)-1-(2-chloro-4-nitrophenyl)-5-oxo-2-pyrrol-1-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 42553672 |
| Molecular Formula | C27H19ClN4O5 |
| Molecular Weight | 514.93 g/mol |
| Exact Mass | 514.10 |
| IUPAC Name | (4R)-4-(1,3-benzodioxol-5-yl)-1-(2-chloro-4-nitrophenyl)-5-oxo-2-pyrrol-1-yl-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | N#CC1=C(n2cccc2)N(c2ccc([N+](=O)[O-])cc2Cl)C2=C(C(=O)CCC2)[C@@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H19ClN4O5/c28-19-13-17(32(34)35)7-8-20(19)31-21-4-3-5-22(33)26(21)25(16-6-9-23-24(12-16)37-15-36-23)18(14-29)27(31)30-10-1-2-11-30/h1-2,6-13,25H,3-5,15H2/t25-/m1/s1 |
| InChIKey | OXIQZFDCGWFPHA-RUZDIDTESA-N |
| XLogP | 5.78 |
| TPSA | 110.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.93 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|